C16H15F2N3 — CID 102624259
2-[2-amino-5-[2-(3,5-difluorophenyl)ethylamino]phenyl]acetonitrile (PubChem CID 102624259) has the molecular formula C16H15F2N3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[2-amino-5-[2-(3,5-difluorophenyl)ethylamino]phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-[2-(3,5-difluorophenyl)ethylamino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624259 |
| Molecular Formula | C16H15F2N3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[2-amino-5-[2-(3,5-difluorophenyl)ethylamino]phenyl]acetonitrile |
| SMILES | N#CCc1cc(NCCc2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C16H15F2N3/c17-13-7-11(8-14(18)10-13)4-6-21-15-1-2-16(20)12(9-15)3-5-19/h1-2,7-10,21H,3-4,6,20H2 |
| InChIKey | GSGRHKSIVGHTNS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|