C12H17N3S — CID 102624367
2-[2-amino-5-(3-methylsulfanylpropylamino)phenyl]acetonitrile (PubChem CID 102624367) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2-[2-amino-5-(3-methylsulfanylpropylamino)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(3-methylsulfanylpropylamino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624367 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[2-amino-5-(3-methylsulfanylpropylamino)phenyl]acetonitrile |
| SMILES | CSCCCNc1ccc(N)c(CC#N)c1 |
| InChI | InChI=1S/C12H17N3S/c1-16-8-2-7-15-11-3-4-12(14)10(9-11)5-6-13/h3-4,9,15H,2,5,7-8,14H2,1H3 |
| InChIKey | LXUDZKLYLLFVQJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|