C11H11F4N3 — CID 106289860
2-[2-amino-5-(2,2,3,3-tetrafluoropropylamino)phenyl]acetonitrile (PubChem CID 106289860) has the molecular formula C11H11F4N3 and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-[2-amino-5-(2,2,3,3-tetrafluoropropylamino)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(2,2,3,3-tetrafluoropropylamino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 106289860 |
| Molecular Formula | C11H11F4N3 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[2-amino-5-(2,2,3,3-tetrafluoropropylamino)phenyl]acetonitrile |
| SMILES | N#CCc1cc(NCC(F)(F)C(F)F)ccc1N |
| InChI | InChI=1S/C11H11F4N3/c12-10(13)11(14,15)6-18-8-1-2-9(17)7(5-8)3-4-16/h1-2,5,10,18H,3,6,17H2 |
| InChIKey | VEOVJOHSQYTZJC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|