C10H9F4N3 — CID 114169063
4-amino-3-(2,2,3,3-tetrafluoropropylamino)benzonitrile (PubChem CID 114169063) has the molecular formula C10H9F4N3 and a molecular weight of 247.20 g/mol. Its IUPAC name is 4-amino-3-(2,2,3,3-tetrafluoropropylamino)benzonitrile.
| Compound Name | 4-amino-3-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
|---|---|
| PubChem CID | 114169063 |
| Molecular Formula | C10H9F4N3 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-amino-3-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
| SMILES | N#Cc1ccc(N)c(NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H9F4N3/c11-9(12)10(13,14)5-17-8-3-6(4-15)1-2-7(8)16/h1-3,9,17H,5,16H2 |
| InChIKey | KLOINYAKGCOZBT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|