C9H9F2N3 — CID 115405395
3-amino-4-(2,2-difluoroethylamino)benzonitrile (PubChem CID 115405395) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-amino-4-(2,2-difluoroethylamino)benzonitrile.
| Compound Name | 3-amino-4-(2,2-difluoroethylamino)benzonitrile |
|---|---|
| PubChem CID | 115405395 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-amino-4-(2,2-difluoroethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCC(F)F)c(N)c1 |
| InChI | InChI=1S/C9H9F2N3/c10-9(11)5-14-8-2-1-6(4-12)3-7(8)13/h1-3,9,14H,5,13H2 |
| InChIKey | UUPNRGDCBISVLK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|