C9H8F2N2 — CID 60922387
3-(2,2-difluoroethylamino)benzonitrile (PubChem CID 60922387) has the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-(2,2-difluoroethylamino)benzonitrile.
| Compound Name | 3-(2,2-difluoroethylamino)benzonitrile |
|---|---|
| PubChem CID | 60922387 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-(2,2-difluoroethylamino)benzonitrile |
| SMILES | N#Cc1cccc(NCC(F)F)c1 |
| InChI | InChI=1S/C9H8F2N2/c10-9(11)6-13-8-3-1-2-7(4-8)5-12/h1-4,9,13H,6H2 |
| InChIKey | DXAATLHGHNFJOE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |