C9H7BrF2N2 — CID 102817004
3-bromo-5-(2,2-difluoroethylamino)benzonitrile (PubChem CID 102817004) has the molecular formula C9H7BrF2N2 and a molecular weight of 261.07 g/mol. Its IUPAC name is 3-bromo-5-(2,2-difluoroethylamino)benzonitrile.
| Compound Name | 3-bromo-5-(2,2-difluoroethylamino)benzonitrile |
|---|---|
| PubChem CID | 102817004 |
| Molecular Formula | C9H7BrF2N2 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 3-bromo-5-(2,2-difluoroethylamino)benzonitrile |
| SMILES | N#Cc1cc(Br)cc(NCC(F)F)c1 |
| InChI | InChI=1S/C9H7BrF2N2/c10-7-1-6(4-13)2-8(3-7)14-5-9(11)12/h1-3,9,14H,5H2 |
| InChIKey | DFYDRHHNCOAQTL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |