C13H18N2 — CID 102816588
3-(2,3-dimethylbutylamino)benzonitrile (PubChem CID 102816588) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(2,3-dimethylbutylamino)benzonitrile.
| Compound Name | 3-(2,3-dimethylbutylamino)benzonitrile |
|---|---|
| PubChem CID | 102816588 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-(2,3-dimethylbutylamino)benzonitrile |
| SMILES | CC(C)C(C)CNc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H18N2/c1-10(2)11(3)9-15-13-6-4-5-12(7-13)8-14/h4-7,10-11,15H,9H2,1-3H3 |
| InChIKey | LAIBVFKDNFVISC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |