C13H17BrN2 — CID 82797095
3-bromo-4-(2,3-dimethylbutylamino)benzonitrile (PubChem CID 82797095) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dimethylbutylamino)benzonitrile.
| Compound Name | 3-bromo-4-(2,3-dimethylbutylamino)benzonitrile |
|---|---|
| PubChem CID | 82797095 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-bromo-4-(2,3-dimethylbutylamino)benzonitrile |
| SMILES | CC(C)C(C)CNc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C13H17BrN2/c1-9(2)10(3)8-16-13-5-4-11(7-15)6-12(13)14/h4-6,9-10,16H,8H2,1-3H3 |
| InChIKey | WURSQUYZKRIDMN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |