C12H17N3 — CID 64596884
4-(2,3-dimethylbutylamino)pyridine-2-carbonitrile (PubChem CID 64596884) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-(2,3-dimethylbutylamino)pyridine-2-carbonitrile.
| Compound Name | 4-(2,3-dimethylbutylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 64596884 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 4-(2,3-dimethylbutylamino)pyridine-2-carbonitrile |
| SMILES | CC(C)C(C)CNc1ccnc(C#N)c1 |
| InChI | InChI=1S/C12H17N3/c1-9(2)10(3)8-15-11-4-5-14-12(6-11)7-13/h4-6,9-10H,8H2,1-3H3,(H,14,15) |
| InChIKey | ADEKNNNQKXXUKZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |