C13H19N3 — CID 115325582
4-(5-methylhexylamino)pyridine-2-carbonitrile (PubChem CID 115325582) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-(5-methylhexylamino)pyridine-2-carbonitrile.
| Compound Name | 4-(5-methylhexylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115325582 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-(5-methylhexylamino)pyridine-2-carbonitrile |
| SMILES | CC(C)CCCCNc1ccnc(C#N)c1 |
| InChI | InChI=1S/C13H19N3/c1-11(2)5-3-4-7-15-12-6-8-16-13(9-12)10-14/h6,8-9,11H,3-5,7H2,1-2H3,(H,15,16) |
| InChIKey | WHXAUIMXZUHHOC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|