C9H12N4 — CID 62926383
4-(3-aminopropylamino)pyridine-2-carbonitrile (PubChem CID 62926383) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-(3-aminopropylamino)pyridine-2-carbonitrile.
| Compound Name | 4-(3-aminopropylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62926383 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 4-(3-aminopropylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(NCCCN)ccn1 |
| InChI | InChI=1S/C9H12N4/c10-3-1-4-12-8-2-5-13-9(6-8)7-11/h2,5-6H,1,3-4,10H2,(H,12,13) |
| InChIKey | CKNLWPJIKOMCRY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|