C12H13N5 — CID 62924993
4-(3-imidazol-1-ylpropylamino)pyridine-2-carbonitrile (PubChem CID 62924993) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylpropylamino)pyridine-2-carbonitrile.
| Compound Name | 4-(3-imidazol-1-ylpropylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62924993 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(3-imidazol-1-ylpropylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(NCCCn2ccnc2)ccn1 |
| InChI | InChI=1S/C12H13N5/c13-9-12-8-11(2-4-16-12)15-3-1-6-17-7-5-14-10-17/h2,4-5,7-8,10H,1,3,6H2,(H,15,16) |
| InChIKey | DMRUQQAWNZXCQO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|