C13H16N6 — CID 107544221
2-(4-imidazol-1-ylbutylamino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107544221) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(4-imidazol-1-ylbutylamino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(4-imidazol-1-ylbutylamino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107544221 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(4-imidazol-1-ylbutylamino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C13H16N6/c1-11-8-12(9-14)18-13(17-11)16-4-2-3-6-19-7-5-15-10-19/h5,7-8,10H,2-4,6H2,1H3,(H,16,17,18) |
| InChIKey | FBCXAGKQIWSGME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|