C18H21N7 — CID 666095
N-(3-imidazol-1-ylpropyl)-4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine (PubChem CID 666095) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 666095 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine |
| SMILES | Cc1cc(C)c2c(n1)nn1c(NCCCn3ccnc3)cc(C)nc21 |
| InChI | InChI=1S/C18H21N7/c1-12-9-13(2)21-17-16(12)18-22-14(3)10-15(25(18)23-17)20-5-4-7-24-8-6-19-11-24/h6,8-11,20H,4-5,7H2,1-3H3 |
| InChIKey | QFYDYEWOLWUWAN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|