C10H12Cl2N6 — CID 55124703
4,6-dichloro-N-(4-imidazol-1-ylbutyl)-1,3,5-triazin-2-amine (PubChem CID 55124703) has the molecular formula C10H12Cl2N6 and a molecular weight of 287.15 g/mol. Its IUPAC name is 4,6-dichloro-N-(4-imidazol-1-ylbutyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(4-imidazol-1-ylbutyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55124703 |
| Molecular Formula | C10H12Cl2N6 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4,6-dichloro-N-(4-imidazol-1-ylbutyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C10H12Cl2N6/c11-8-15-9(12)17-10(16-8)14-3-1-2-5-18-6-4-13-7-18/h4,6-7H,1-3,5H2,(H,14,15,16,17) |
| InChIKey | IPCDIZQAETUXEN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|