C13H18ClN7 — CID 62869150
4-chloro-N-(3-imidazol-1-ylpropyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 62869150) has the molecular formula C13H18ClN7 and a molecular weight of 307.79 g/mol. Its IUPAC name is 4-chloro-N-(3-imidazol-1-ylpropyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62869150 |
| Molecular Formula | C13H18ClN7 |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(NCCCn2ccnc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H18ClN7/c14-11-17-12(16-4-3-6-20-9-5-15-10-20)19-13(18-11)21-7-1-2-8-21/h5,9-10H,1-4,6-8H2,(H,16,17,18,19) |
| InChIKey | DKEJORFVZJULSA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|