C12H12ClN7 — CID 82459615
2-chloro-N-(3-imidazol-1-ylpropyl)pteridin-4-amine (PubChem CID 82459615) has the molecular formula C12H12ClN7 and a molecular weight of 289.73 g/mol. Its IUPAC name is 2-chloro-N-(3-imidazol-1-ylpropyl)pteridin-4-amine.
| Compound Name | 2-chloro-N-(3-imidazol-1-ylpropyl)pteridin-4-amine |
|---|---|
| PubChem CID | 82459615 |
| Molecular Formula | C12H12ClN7 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-chloro-N-(3-imidazol-1-ylpropyl)pteridin-4-amine |
| SMILES | Clc1nc(NCCCn2ccnc2)c2nccnc2n1 |
| InChI | InChI=1S/C12H12ClN7/c13-12-18-10(9-11(19-12)17-4-3-15-9)16-2-1-6-20-7-5-14-8-20/h3-5,7-8H,1-2,6H2,(H,16,17,18,19) |
| InChIKey | KJORMNUPBBDQHR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|