C12H14ClN7 — CID 82460088
6-chloro-N-(3-imidazol-1-ylpropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 82460088) has the molecular formula C12H14ClN7 and a molecular weight of 291.75 g/mol. Its IUPAC name is 6-chloro-N-(3-imidazol-1-ylpropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(3-imidazol-1-ylpropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82460088 |
| Molecular Formula | C12H14ClN7 |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 6-chloro-N-(3-imidazol-1-ylpropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCCCn3ccnc3)nc(Cl)nc21 |
| InChI | InChI=1S/C12H14ClN7/c1-19-11-9(7-16-19)10(17-12(13)18-11)15-3-2-5-20-6-4-14-8-20/h4,6-8H,2-3,5H2,1H3,(H,15,17,18) |
| InChIKey | YLVFUXLWTROWJP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|