C15H19N5S — CID 35475062
N-(3-imidazol-1-ylpropyl)-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 35475062) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 35475062 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NCCCn2ccnc2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C15H19N5S/c1-10-11(2)21-15-13(10)14(18-12(3)19-15)17-5-4-7-20-8-6-16-9-20/h6,8-9H,4-5,7H2,1-3H3,(H,17,18,19) |
| InChIKey | MFSQHNNDDHZGMM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|