C14H21N3S — CID 91965462
N-butyl-2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 91965462) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-butyl-2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91965462 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-butyl-2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(CC)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C14H21N3S/c1-5-7-8-15-13-12-9(3)10(4)18-14(12)17-11(6-2)16-13/h5-8H2,1-4H3,(H,15,16,17) |
| InChIKey | KFGRTGPJYLLJST-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|