C18H21N3OS2 — CID 9280410
3-[[5,6-dimethyl-2-(phenylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 9280410) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 3-[[5,6-dimethyl-2-(phenylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5,6-dimethyl-2-(phenylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 9280410 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[[5,6-dimethyl-2-(phenylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | Cc1sc2nc(CSc3ccccc3)nc(NCCCO)c2c1C |
| InChI | InChI=1S/C18H21N3OS2/c1-12-13(2)24-18-16(12)17(19-9-6-10-22)20-15(21-18)11-23-14-7-4-3-5-8-14/h3-5,7-8,22H,6,9-11H2,1-2H3,(H,19,20,21) |
| InChIKey | ATMWZDRDHPGDDC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|