C16H18N4OS — CID 17410711
3-[(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol (PubChem CID 17410711) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 17410711 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
| SMILES | Cc1sc2nc(-c3cccnc3)nc(NCCCO)c2c1C |
| InChI | InChI=1S/C16H18N4OS/c1-10-11(2)22-16-13(10)15(18-7-4-8-21)19-14(20-16)12-5-3-6-17-9-12/h3,5-6,9,21H,4,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | JVBSPAOCBXLLQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|