C20H26N4S — CID 91964658
N-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 91964658) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is N-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 91964658 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1sc2nc(Cc3ccccc3)nc(NCCCN(C)C)c2c1C |
| InChI | InChI=1S/C20H26N4S/c1-14-15(2)25-20-18(14)19(21-11-8-12-24(3)4)22-17(23-20)13-16-9-6-5-7-10-16/h5-7,9-10H,8,11-13H2,1-4H3,(H,21,22,23) |
| InChIKey | OPNXWTWHOXMEQS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|