C18H19N3S — CID 91964684
2-benzyl-5,6-dimethyl-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 91964684) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-benzyl-5,6-dimethyl-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-benzyl-5,6-dimethyl-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91964684 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-benzyl-5,6-dimethyl-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCNc1nc(Cc2ccccc2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C18H19N3S/c1-4-10-19-17-16-12(2)13(3)22-18(16)21-15(20-17)11-14-8-6-5-7-9-14/h4-9H,1,10-11H2,2-3H3,(H,19,20,21) |
| InChIKey | MXKLUTZWVROKCV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|