C16H23N9 — CID 19154189
4-N,6-N-bis(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19154189) has the molecular formula C16H23N9 and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-N,6-N-bis(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-bis(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19154189 |
| Molecular Formula | C16H23N9 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-N,6-N-bis(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCn2ccnc2)ncnc1NCCCn1ccnc1 |
| InChI | InChI=1S/C16H23N9/c17-14-15(20-3-1-7-24-9-5-18-12-24)22-11-23-16(14)21-4-2-8-25-10-6-19-13-25/h5-6,9-13H,1-4,7-8,17H2,(H2,20,21,22,23) |
| InChIKey | RPDIZYMCSBRNDJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|