C18H23N7 — CID 22539915
4-N-ethyl-6-N-(3-imidazol-1-ylpropyl)-4-N-phenylpyrimidine-4,5,6-triamine (PubChem CID 22539915) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(3-imidazol-1-ylpropyl)-4-N-phenylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-ethyl-6-N-(3-imidazol-1-ylpropyl)-4-N-phenylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22539915 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-N-ethyl-6-N-(3-imidazol-1-ylpropyl)-4-N-phenylpyrimidine-4,5,6-triamine |
| SMILES | CCN(c1ccccc1)c1ncnc(NCCCn2ccnc2)c1N |
| InChI | InChI=1S/C18H23N7/c1-2-25(15-7-4-3-5-8-15)18-16(19)17(22-13-23-18)21-9-6-11-24-12-10-20-14-24/h3-5,7-8,10,12-14H,2,6,9,11,19H2,1H3,(H,21,22,23) |
| InChIKey | QHQFHOCYYIMPHK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|