C18H22N8O2 — CID 19151497
N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 19151497) has the molecular formula C18H22N8O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19151497 |
| Molecular Formula | C18H22N8O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(NCCCn2ccnc2)c1N |
| InChI | InChI=1S/C18H22N8O2/c1-28-14-6-3-2-5-13(14)18(27)25-24-17-15(19)16(22-11-23-17)21-7-4-9-26-10-8-20-12-26/h2-3,5-6,8,10-12H,4,7,9,19H2,1H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | OHXNMUDIIFDEFD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|