C17H18Cl2N8O — CID 19151722
N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19151722) has the molecular formula C17H18Cl2N8O and a molecular weight of 421.29 g/mol. Its IUPAC name is N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19151722 |
| Molecular Formula | C17H18Cl2N8O |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N'-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | Nc1c(NCCCn2ccnc2)ncnc1NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N8O/c18-11-2-3-12(13(19)8-11)17(28)26-25-16-14(20)15(23-9-24-16)22-4-1-6-27-7-5-21-10-27/h2-3,5,7-10H,1,4,6,20H2,(H,26,28)(H2,22,23,24,25) |
| InChIKey | CCWZUYIMSSSHGM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|