C15H17ClN8 — CID 19154198
4-N-(2-chloro-3-pyridinyl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19154198) has the molecular formula C15H17ClN8 and a molecular weight of 344.81 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19154198 |
| Molecular Formula | C15H17ClN8 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCn2ccnc2)ncnc1Nc1cccnc1Cl |
| InChI | InChI=1S/C15H17ClN8/c16-13-11(3-1-4-19-13)23-15-12(17)14(21-9-22-15)20-5-2-7-24-8-6-18-10-24/h1,3-4,6,8-10H,2,5,7,17H2,(H2,20,21,22,23) |
| InChIKey | PZAMNLWUJWMJRG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|