C17H18N8S — CID 19146041
4-N-(1,3-benzothiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19146041) has the molecular formula C17H18N8S and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19146041 |
| Molecular Formula | C17H18N8S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCn2ccnc2)ncnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H18N8S/c18-14-15(20-6-3-8-25-9-7-19-11-25)21-10-22-16(14)24-17-23-12-4-1-2-5-13(12)26-17/h1-2,4-5,7,9-11H,3,6,8,18H2,(H2,20,21,22,23,24) |
| InChIKey | XHWXYOLWZVJESP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|