C14H23N7O — CID 19144273
6-N-(3-imidazol-1-ylpropyl)-4-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine (PubChem CID 19144273) has the molecular formula C14H23N7O and a molecular weight of 305.39 g/mol. Its IUPAC name is 6-N-(3-imidazol-1-ylpropyl)-4-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(3-imidazol-1-ylpropyl)-4-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19144273 |
| Molecular Formula | C14H23N7O |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 6-N-(3-imidazol-1-ylpropyl)-4-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
| SMILES | COCCCNc1ncnc(NCCCn2ccnc2)c1N |
| InChI | InChI=1S/C14H23N7O/c1-22-9-3-5-18-14-12(15)13(19-10-20-14)17-4-2-7-21-8-6-16-11-21/h6,8,10-11H,2-5,7,9,15H2,1H3,(H2,17,18,19,20) |
| InChIKey | HBXMEFYCKHPYCF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|