C14H22N6O — CID 82455220
4-N-(3-imidazol-1-ylpropyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine (PubChem CID 82455220) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-N-(3-imidazol-1-ylpropyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-imidazol-1-ylpropyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455220 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 4-N-(3-imidazol-1-ylpropyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
| SMILES | CC(C)COc1ncnc(NCCCn2ccnc2)c1N |
| InChI | InChI=1S/C14H22N6O/c1-11(2)8-21-14-12(15)13(18-9-19-14)17-4-3-6-20-7-5-16-10-20/h5,7,9-11H,3-4,6,8,15H2,1-2H3,(H,17,18,19) |
| InChIKey | QMDOCLNCBZJIFT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|