C15H18N8O2S — CID 22533991
4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22533991) has the molecular formula C15H18N8O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22533991 |
| Molecular Formula | C15H18N8O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ncnc(NCCCn3ccnc3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C15H18N8O2S/c1-10-11(2)26-15(20-10)21-14-12(23(24)25)13(18-8-19-14)17-4-3-6-22-7-5-16-9-22/h5,7-9H,3-4,6H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | XJDAWJJZIAUYIV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|