C17H17BrN8O3 — CID 22535496
4-bromo-N'-[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535496) has the molecular formula C17H17BrN8O3 and a molecular weight of 461.28 g/mol. Its IUPAC name is 4-bromo-N'-[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-bromo-N'-[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535496 |
| Molecular Formula | C17H17BrN8O3 |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-bromo-N'-[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(NCCCn2ccnc2)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN8O3/c18-13-4-2-12(3-5-13)17(27)24-23-16-14(26(28)29)15(21-10-22-16)20-6-1-8-25-9-7-19-11-25/h2-5,7,9-11H,1,6,8H2,(H,24,27)(H2,20,21,22,23) |
| InChIKey | GLGHYXNHPLJFRK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|