C15H15ClN6S — CID 19154358
4-N-(2-chloro-3-pyridinyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,5,6-triamine (PubChem CID 19154358) has the molecular formula C15H15ClN6S and a molecular weight of 346.85 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19154358 |
| Molecular Formula | C15H15ClN6S |
| Molecular Weight | 346.85 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(2-thiophen-2-ylethyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCc2cccs2)ncnc1Nc1cccnc1Cl |
| InChI | InChI=1S/C15H15ClN6S/c16-13-11(4-1-6-18-13)22-15-12(17)14(20-9-21-15)19-7-5-10-3-2-8-23-10/h1-4,6,8-9H,5,7,17H2,(H2,19,20,21,22) |
| InChIKey | ANABLWMNSFYNEB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|