C18H19N5OS — CID 19149391
1-[4-[[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 19149391) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 1-[4-[[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 19149391 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-[4-[[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc(NCCc3cccs3)c2N)cc1 |
| InChI | InChI=1S/C18H19N5OS/c1-12(24)13-4-6-14(7-5-13)23-18-16(19)17(21-11-22-18)20-9-8-15-3-2-10-25-15/h2-7,10-11H,8-9,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | PCPITMPBVIPZAF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |