C12H13N5O — CID 19137147
1-[4-[(5,6-diaminopyrimidin-4-yl)amino]phenyl]ethanone (PubChem CID 19137147) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 1-[4-[(5,6-diaminopyrimidin-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[4-[(5,6-diaminopyrimidin-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 19137147 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-[4-[(5,6-diaminopyrimidin-4-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc(N)c2N)cc1 |
| InChI | InChI=1S/C12H13N5O/c1-7(18)8-2-4-9(5-3-8)17-12-10(13)11(14)15-6-16-12/h2-6H,13H2,1H3,(H3,14,15,16,17) |
| InChIKey | NBKBIGFFPHXYEO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |