C20H18N4O2 — CID 112866665
1-[4-[[6-(4-acetylanilino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112866665) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[4-[[6-(4-acetylanilino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[6-(4-acetylanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112866665 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[4-[[6-(4-acetylanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2cc(Nc3ccc(C(C)=O)cc3)ncn2)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-13(25)15-3-7-17(8-4-15)23-19-11-20(22-12-21-19)24-18-9-5-16(6-10-18)14(2)26/h3-12H,1-2H3,(H2,21,22,23,24) |
| InChIKey | FTJURIQUPQZIHC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |