C20H18N4O4 — CID 112866836
methyl 4-[[6-(4-methoxycarbonylanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112866836) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is methyl 4-[[6-(4-methoxycarbonylanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-(4-methoxycarbonylanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112866836 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 4-[[6-(4-methoxycarbonylanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(Nc3ccc(C(=O)OC)cc3)ncn2)cc1 |
| InChI | InChI=1S/C20H18N4O4/c1-27-19(25)13-3-7-15(8-4-13)23-17-11-18(22-12-21-17)24-16-9-5-14(6-10-16)20(26)28-2/h3-12H,1-2H3,(H2,21,22,23,24) |
| InChIKey | LTKNVWINGDHETP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |