C14H17N5O3 — CID 19151456
N'-(5-amino-6-ethoxypyrimidin-4-yl)-2-methoxybenzohydrazide (PubChem CID 19151456) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N'-(5-amino-6-ethoxypyrimidin-4-yl)-2-methoxybenzohydrazide.
| Compound Name | N'-(5-amino-6-ethoxypyrimidin-4-yl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19151456 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N'-(5-amino-6-ethoxypyrimidin-4-yl)-2-methoxybenzohydrazide |
| SMILES | CCOc1ncnc(NNC(=O)c2ccccc2OC)c1N |
| InChI | InChI=1S/C14H17N5O3/c1-3-22-14-11(15)12(16-8-17-14)18-19-13(20)9-6-4-5-7-10(9)21-2/h4-8H,3,15H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | JWYAOIBXXAKDJK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|