C20H21N5O2 — CID 19152171
N'-(5-amino-6-ethoxypyrimidin-4-yl)-2,2-diphenylacetohydrazide (PubChem CID 19152171) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N'-(5-amino-6-ethoxypyrimidin-4-yl)-2,2-diphenylacetohydrazide.
| Compound Name | N'-(5-amino-6-ethoxypyrimidin-4-yl)-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19152171 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-(5-amino-6-ethoxypyrimidin-4-yl)-2,2-diphenylacetohydrazide |
| SMILES | CCOc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C20H21N5O2/c1-2-27-20-17(21)18(22-13-23-20)24-25-19(26)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,2,21H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | VIYMXIRALCPFIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|