C27H22N6O2 — CID 19141820
N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2,2-diphenylacetohydrazide (PubChem CID 19141820) has the molecular formula C27H22N6O2 and a molecular weight of 462.51 g/mol. Its IUPAC name is N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2,2-diphenylacetohydrazide.
| Compound Name | N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19141820 |
| Molecular Formula | C27H22N6O2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1Oc1cccc2cccnc12 |
| InChI | InChI=1S/C27H22N6O2/c28-23-25(30-17-31-27(23)35-21-15-7-13-20-14-8-16-29-24(20)21)32-33-26(34)22(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,22H,28H2,(H,33,34)(H,30,31,32) |
| InChIKey | HFDYFRNGQAWONT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|