C16H15N5O — CID 19135970
4-N-prop-2-enyl-6-quinolin-8-yloxypyrimidine-4,5-diamine (PubChem CID 19135970) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-N-prop-2-enyl-6-quinolin-8-yloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-prop-2-enyl-6-quinolin-8-yloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19135970 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-N-prop-2-enyl-6-quinolin-8-yloxypyrimidine-4,5-diamine |
| SMILES | C=CCNc1ncnc(Oc2cccc3cccnc23)c1N |
| InChI | InChI=1S/C16H15N5O/c1-2-8-19-15-13(17)16(21-10-20-15)22-12-7-3-5-11-6-4-9-18-14(11)12/h2-7,9-10H,1,8,17H2,(H,19,20,21) |
| InChIKey | CWHOCYQGHSXBIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|