C21H18N6O2 — CID 19141803
N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2-methylbenzohydrazide (PubChem CID 19141803) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2-methylbenzohydrazide.
| Compound Name | N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19141803 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N'-(5-amino-6-quinolin-8-yloxypyrimidin-4-yl)-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(Oc2cccc3cccnc23)c1N |
| InChI | InChI=1S/C21H18N6O2/c1-13-6-2-3-9-15(13)20(28)27-26-19-17(22)21(25-12-24-19)29-16-10-4-7-14-8-5-11-23-18(14)16/h2-12H,22H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | OHPIZVUNYURCEW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|