C21H15BrN6O4 — CID 22535286
N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 22535286) has the molecular formula C21H15BrN6O4 and a molecular weight of 495.29 g/mol. Its IUPAC name is N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 22535286 |
| Molecular Formula | C21H15BrN6O4 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(Oc2ccc(Br)c3cccnc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15BrN6O4/c1-12-5-2-3-6-13(12)20(29)27-26-19-18(28(30)31)21(25-11-24-19)32-16-9-8-15(22)14-7-4-10-23-17(14)16/h2-11H,1H3,(H,27,29)(H,24,25,26) |
| InChIKey | RAVMSMWPACBKIG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|