C21H16BrN5O3 — CID 23485772
6-(5-bromoquinolin-8-yl)oxy-N-(2,5-dimethylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23485772) has the molecular formula C21H16BrN5O3 and a molecular weight of 466.30 g/mol. Its IUPAC name is 6-(5-bromoquinolin-8-yl)oxy-N-(2,5-dimethylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(5-bromoquinolin-8-yl)oxy-N-(2,5-dimethylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23485772 |
| Molecular Formula | C21H16BrN5O3 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 6-(5-bromoquinolin-8-yl)oxy-N-(2,5-dimethylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(C)c(Nc2ncnc(Oc3ccc(Br)c4cccnc34)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16BrN5O3/c1-12-5-6-13(2)16(10-12)26-20-19(27(28)29)21(25-11-24-20)30-17-8-7-15(22)14-4-3-9-23-18(14)17/h3-11H,1-2H3,(H,24,25,26) |
| InChIKey | JDMKXGFARCVTIN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|