C21H17N5O3 — CID 23479406
N-(3,5-dimethylphenyl)-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine (PubChem CID 23479406) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine.
| Compound Name | N-(3,5-dimethylphenyl)-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 23479406 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(3,5-dimethylphenyl)-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine |
| SMILES | Cc1cc(C)cc(Nc2ncnc(Oc3cccc4cccnc34)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N5O3/c1-13-9-14(2)11-16(10-13)25-20-19(26(27)28)21(24-12-23-20)29-17-7-3-5-15-6-4-8-22-18(15)17/h3-12H,1-2H3,(H,23,24,25) |
| InChIKey | NOEVULKHCQFSCA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|