C20H14BrN5O3 — CID 23494053
N-(3-bromophenyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine (PubChem CID 23494053) has the molecular formula C20H14BrN5O3 and a molecular weight of 452.27 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23494053 |
| Molecular Formula | C20H14BrN5O3 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-(3-bromophenyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc2cccc(Oc3ncnc(Nc4cccc(Br)c4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C20H14BrN5O3/c1-12-8-9-13-4-2-7-16(17(13)24-12)29-20-18(26(27)28)19(22-11-23-20)25-15-6-3-5-14(21)10-15/h2-11H,1H3,(H,22,23,25) |
| InChIKey | SYAYKAYVWRMVCN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|