C19H13ClN6O3 — CID 23493980
N-(5-chloro-2-pyridinyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine (PubChem CID 23493980) has the molecular formula C19H13ClN6O3 and a molecular weight of 408.81 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine.
| Compound Name | N-(5-chloro-2-pyridinyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23493980 |
| Molecular Formula | C19H13ClN6O3 |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc2cccc(Oc3ncnc(Nc4ccc(Cl)cn4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C19H13ClN6O3/c1-11-5-6-12-3-2-4-14(16(12)24-11)29-19-17(26(27)28)18(22-10-23-19)25-15-8-7-13(20)9-21-15/h2-10H,1H3,(H,21,22,23,25) |
| InChIKey | OWNNCZWBXSVOQG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|